C22H27NO5S2 — CID 90585691
1-[2-(benzenesulfonylmethyl)pyrrolidin-1-yl]-2-(4-propan-2-ylsulfonylphenyl)ethanone (PubChem CID 90585691) has the molecular formula C22H27NO5S2 and a molecular weight of 449.59 g/mol. Its IUPAC name is 1-[2-(benzenesulfonylmethyl)pyrrolidin-1-yl]-2-(4-propan-2-ylsulfonylphenyl)ethanone.
| Compound Name | 1-[2-(benzenesulfonylmethyl)pyrrolidin-1-yl]-2-(4-propan-2-ylsulfonylphenyl)ethanone |
|---|---|
| PubChem CID | 90585691 |
| Molecular Formula | C22H27NO5S2 |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 1-[2-(benzenesulfonylmethyl)pyrrolidin-1-yl]-2-(4-propan-2-ylsulfonylphenyl)ethanone |
| SMILES | CC(C)S(=O)(=O)c1ccc(CC(=O)N2CCCC2CS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H27NO5S2/c1-17(2)30(27,28)21-12-10-18(11-13-21)15-22(24)23-14-6-7-19(23)16-29(25,26)20-8-4-3-5-9-20/h3-5,8-13,17,19H,6-7,14-16H2,1-2H3 |
| InChIKey | WKMQCBKZDJYZBD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |