C16H22BrNO4S — CID 90586402
3-(5-bromo-2-methoxyphenyl)-1-(4-methylsulfonylpiperidin-1-yl)propan-1-one (PubChem CID 90586402) has the molecular formula C16H22BrNO4S and a molecular weight of 404.33 g/mol. Its IUPAC name is 3-(5-bromo-2-methoxyphenyl)-1-(4-methylsulfonylpiperidin-1-yl)propan-1-one.
| Compound Name | 3-(5-bromo-2-methoxyphenyl)-1-(4-methylsulfonylpiperidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 90586402 |
| Molecular Formula | C16H22BrNO4S |
| Molecular Weight | 404.33 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | 3-(5-bromo-2-methoxyphenyl)-1-(4-methylsulfonylpiperidin-1-yl)propan-1-one |
| SMILES | COc1ccc(Br)cc1CCC(=O)N1CCC(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C16H22BrNO4S/c1-22-15-5-4-13(17)11-12(15)3-6-16(19)18-9-7-14(8-10-18)23(2,20)21/h4-5,11,14H,3,6-10H2,1-2H3 |
| InChIKey | JXMHRDMDJRYOPS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |