C25H24ClNO3S — CID 90587776
1-[3-(4-chlorophenyl)sulfonylpyrrolidin-1-yl]-3,3-diphenylpropan-1-one (PubChem CID 90587776) has the molecular formula C25H24ClNO3S and a molecular weight of 453.99 g/mol. Its IUPAC name is 1-[3-(4-chlorophenyl)sulfonylpyrrolidin-1-yl]-3,3-diphenylpropan-1-one.
| Compound Name | 1-[3-(4-chlorophenyl)sulfonylpyrrolidin-1-yl]-3,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 90587776 |
| Molecular Formula | C25H24ClNO3S |
| Molecular Weight | 453.99 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | 1-[3-(4-chlorophenyl)sulfonylpyrrolidin-1-yl]-3,3-diphenylpropan-1-one |
| SMILES | O=C(CC(c1ccccc1)c1ccccc1)N1CCC(S(=O)(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C25H24ClNO3S/c26-21-11-13-22(14-12-21)31(29,30)23-15-16-27(18-23)25(28)17-24(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-14,23-24H,15-18H2 |
| InChIKey | CXRBQCVBEGLFCN-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.99 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |