C21H22ClNO4S — CID 97417180
1-[(3R)-3-(4-chlorophenyl)sulfonylpyrrolidin-1-yl]-5-phenylpentane-1,5-dione (PubChem CID 97417180) has the molecular formula C21H22ClNO4S and a molecular weight of 419.93 g/mol. Its IUPAC name is 1-[(3R)-3-(4-chlorophenyl)sulfonylpyrrolidin-1-yl]-5-phenylpentane-1,5-dione.
| Compound Name | 1-[(3R)-3-(4-chlorophenyl)sulfonylpyrrolidin-1-yl]-5-phenylpentane-1,5-dione |
|---|---|
| PubChem CID | 97417180 |
| Molecular Formula | C21H22ClNO4S |
| Molecular Weight | 419.93 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 1-[(3R)-3-(4-chlorophenyl)sulfonylpyrrolidin-1-yl]-5-phenylpentane-1,5-dione |
| SMILES | O=C(CCCC(=O)N1CC[C@@H](S(=O)(=O)c2ccc(Cl)cc2)C1)c1ccccc1 |
| InChI | InChI=1S/C21H22ClNO4S/c22-17-9-11-18(12-10-17)28(26,27)19-13-14-23(15-19)21(25)8-4-7-20(24)16-5-2-1-3-6-16/h1-3,5-6,9-12,19H,4,7-8,13-15H2/t19-/m1/s1 |
| InChIKey | MCYQSGFYPHNASM-LJQANCHMSA-N |
| XLogP | 3.77 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.93 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |