C18H20N4O4S — CID 90588175
3,4-dimethoxy-N-[2-(3-pyridin-4-ylpyrazol-1-yl)ethyl]benzenesulfonamide (PubChem CID 90588175) has the molecular formula C18H20N4O4S and a molecular weight of 388.45 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[2-(3-pyridin-4-ylpyrazol-1-yl)ethyl]benzenesulfonamide.
| Compound Name | 3,4-dimethoxy-N-[2-(3-pyridin-4-ylpyrazol-1-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90588175 |
| Molecular Formula | C18H20N4O4S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 3,4-dimethoxy-N-[2-(3-pyridin-4-ylpyrazol-1-yl)ethyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCn2ccc(-c3ccncc3)n2)cc1OC |
| InChI | InChI=1S/C18H20N4O4S/c1-25-17-4-3-15(13-18(17)26-2)27(23,24)20-10-12-22-11-7-16(21-22)14-5-8-19-9-6-14/h3-9,11,13,20H,10,12H2,1-2H3 |
| InChIKey | OFRHYFIKKLYXHJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |