C14H16F3N3O3S — CID 90588716
2-ethoxy-N-[2-[3-(trifluoromethyl)pyrazol-1-yl]ethyl]benzenesulfonamide (PubChem CID 90588716) has the molecular formula C14H16F3N3O3S and a molecular weight of 363.36 g/mol. Its IUPAC name is 2-ethoxy-N-[2-[3-(trifluoromethyl)pyrazol-1-yl]ethyl]benzenesulfonamide.
| Compound Name | 2-ethoxy-N-[2-[3-(trifluoromethyl)pyrazol-1-yl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90588716 |
| Molecular Formula | C14H16F3N3O3S |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 2-ethoxy-N-[2-[3-(trifluoromethyl)pyrazol-1-yl]ethyl]benzenesulfonamide |
| SMILES | CCOc1ccccc1S(=O)(=O)NCCn1ccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C14H16F3N3O3S/c1-2-23-11-5-3-4-6-12(11)24(21,22)18-8-10-20-9-7-13(19-20)14(15,16)17/h3-7,9,18H,2,8,10H2,1H3 |
| InChIKey | YMLXQNQTUWFVJT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |