C13H11F6N3O2S — CID 90588752
3-(trifluoromethyl)-N-[2-[3-(trifluoromethyl)pyrazol-1-yl]ethyl]benzenesulfonamide (PubChem CID 90588752) has the molecular formula C13H11F6N3O2S and a molecular weight of 387.31 g/mol. Its IUPAC name is 3-(trifluoromethyl)-N-[2-[3-(trifluoromethyl)pyrazol-1-yl]ethyl]benzenesulfonamide.
| Compound Name | 3-(trifluoromethyl)-N-[2-[3-(trifluoromethyl)pyrazol-1-yl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90588752 |
| Molecular Formula | C13H11F6N3O2S |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | 3-(trifluoromethyl)-N-[2-[3-(trifluoromethyl)pyrazol-1-yl]ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCn1ccc(C(F)(F)F)n1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H11F6N3O2S/c14-12(15,16)9-2-1-3-10(8-9)25(23,24)20-5-7-22-6-4-11(21-22)13(17,18)19/h1-4,6,8,20H,5,7H2 |
| InChIKey | MGALYVFCMCSDFM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |