C17H22F3NO4S — CID 90590063
[4-(2-methylpropylsulfonyl)piperidin-1-yl]-[4-(trifluoromethoxy)phenyl]methanone (PubChem CID 90590063) has the molecular formula C17H22F3NO4S and a molecular weight of 393.43 g/mol. Its IUPAC name is [4-(2-methylpropylsulfonyl)piperidin-1-yl]-[4-(trifluoromethoxy)phenyl]methanone.
| Compound Name | [4-(2-methylpropylsulfonyl)piperidin-1-yl]-[4-(trifluoromethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 90590063 |
| Molecular Formula | C17H22F3NO4S |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | [4-(2-methylpropylsulfonyl)piperidin-1-yl]-[4-(trifluoromethoxy)phenyl]methanone |
| SMILES | CC(C)CS(=O)(=O)C1CCN(C(=O)c2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C17H22F3NO4S/c1-12(2)11-26(23,24)15-7-9-21(10-8-15)16(22)13-3-5-14(6-4-13)25-17(18,19)20/h3-6,12,15H,7-11H2,1-2H3 |
| InChIKey | KFOWHUNQZUIYMC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |