C16H24N2O3S2 — CID 90590131
1-[4-(2-methylpropylsulfonyl)piperidin-1-yl]-2-pyridin-4-ylsulfanylethanone (PubChem CID 90590131) has the molecular formula C16H24N2O3S2 and a molecular weight of 356.51 g/mol. Its IUPAC name is 1-[4-(2-methylpropylsulfonyl)piperidin-1-yl]-2-pyridin-4-ylsulfanylethanone.
| Compound Name | 1-[4-(2-methylpropylsulfonyl)piperidin-1-yl]-2-pyridin-4-ylsulfanylethanone |
|---|---|
| PubChem CID | 90590131 |
| Molecular Formula | C16H24N2O3S2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 1-[4-(2-methylpropylsulfonyl)piperidin-1-yl]-2-pyridin-4-ylsulfanylethanone |
| SMILES | CC(C)CS(=O)(=O)C1CCN(C(=O)CSc2ccncc2)CC1 |
| InChI | InChI=1S/C16H24N2O3S2/c1-13(2)12-23(20,21)15-5-9-18(10-6-15)16(19)11-22-14-3-7-17-8-4-14/h3-4,7-8,13,15H,5-6,9-12H2,1-2H3 |
| InChIKey | PHPDZGPVECAPPG-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |