C15H17IN4O3S — CID 90592361
(3-iodophenyl)-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfonyl]piperidin-1-yl]methanone (PubChem CID 90592361) has the molecular formula C15H17IN4O3S and a molecular weight of 460.30 g/mol. Its IUPAC name is (3-iodophenyl)-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfonyl]piperidin-1-yl]methanone.
| Compound Name | (3-iodophenyl)-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfonyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 90592361 |
| Molecular Formula | C15H17IN4O3S |
| Molecular Weight | 460.30 g/mol |
| Exact Mass | 460.01 |
| IUPAC Name | (3-iodophenyl)-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfonyl]piperidin-1-yl]methanone |
| SMILES | Cn1cnnc1S(=O)(=O)C1CCN(C(=O)c2cccc(I)c2)CC1 |
| InChI | InChI=1S/C15H17IN4O3S/c1-19-10-17-18-15(19)24(22,23)13-5-7-20(8-6-13)14(21)11-3-2-4-12(16)9-11/h2-4,9-10,13H,5-8H2,1H3 |
| InChIKey | JJYXENNWRARZFO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|