C18H26N2O6S — CID 90592562
2-[1-[2-(4-ethoxyphenoxy)acetyl]piperidin-4-yl]sulfonyl-N-methylacetamide (PubChem CID 90592562) has the molecular formula C18H26N2O6S and a molecular weight of 398.48 g/mol. Its IUPAC name is 2-[1-[2-(4-ethoxyphenoxy)acetyl]piperidin-4-yl]sulfonyl-N-methylacetamide.
| Compound Name | 2-[1-[2-(4-ethoxyphenoxy)acetyl]piperidin-4-yl]sulfonyl-N-methylacetamide |
|---|---|
| PubChem CID | 90592562 |
| Molecular Formula | C18H26N2O6S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 2-[1-[2-(4-ethoxyphenoxy)acetyl]piperidin-4-yl]sulfonyl-N-methylacetamide |
| SMILES | CCOc1ccc(OCC(=O)N2CCC(S(=O)(=O)CC(=O)NC)CC2)cc1 |
| InChI | InChI=1S/C18H26N2O6S/c1-3-25-14-4-6-15(7-5-14)26-12-18(22)20-10-8-16(9-11-20)27(23,24)13-17(21)19-2/h4-7,16H,3,8-13H2,1-2H3,(H,19,21) |
| InChIKey | XZOCSZQGADWZTA-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |