C16H24N2O4S2 — CID 90592622
N-methyl-2-[1-[3-(3-methylthiophen-2-yl)propanoyl]piperidin-4-yl]sulfonylacetamide (PubChem CID 90592622) has the molecular formula C16H24N2O4S2 and a molecular weight of 372.51 g/mol. Its IUPAC name is N-methyl-2-[1-[3-(3-methylthiophen-2-yl)propanoyl]piperidin-4-yl]sulfonylacetamide.
| Compound Name | N-methyl-2-[1-[3-(3-methylthiophen-2-yl)propanoyl]piperidin-4-yl]sulfonylacetamide |
|---|---|
| PubChem CID | 90592622 |
| Molecular Formula | C16H24N2O4S2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | N-methyl-2-[1-[3-(3-methylthiophen-2-yl)propanoyl]piperidin-4-yl]sulfonylacetamide |
| SMILES | CNC(=O)CS(=O)(=O)C1CCN(C(=O)CCc2sccc2C)CC1 |
| InChI | InChI=1S/C16H24N2O4S2/c1-12-7-10-23-14(12)3-4-16(20)18-8-5-13(6-9-18)24(21,22)11-15(19)17-2/h7,10,13H,3-6,8-9,11H2,1-2H3,(H,17,19) |
| InChIKey | DAVXBPYMWBVDGX-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |