C16H25NO3S2 — CID 97427256
1-[(3S)-3-tert-butylsulfonylpyrrolidin-1-yl]-3-(3-methylthiophen-2-yl)propan-1-one (PubChem CID 97427256) has the molecular formula C16H25NO3S2 and a molecular weight of 343.51 g/mol. Its IUPAC name is 1-[(3S)-3-tert-butylsulfonylpyrrolidin-1-yl]-3-(3-methylthiophen-2-yl)propan-1-one.
| Compound Name | 1-[(3S)-3-tert-butylsulfonylpyrrolidin-1-yl]-3-(3-methylthiophen-2-yl)propan-1-one |
|---|---|
| PubChem CID | 97427256 |
| Molecular Formula | C16H25NO3S2 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 1-[(3S)-3-tert-butylsulfonylpyrrolidin-1-yl]-3-(3-methylthiophen-2-yl)propan-1-one |
| SMILES | Cc1ccsc1CCC(=O)N1CC[C@H](S(=O)(=O)C(C)(C)C)C1 |
| InChI | InChI=1S/C16H25NO3S2/c1-12-8-10-21-14(12)5-6-15(18)17-9-7-13(11-17)22(19,20)16(2,3)4/h8,10,13H,5-7,9,11H2,1-4H3/t13-/m0/s1 |
| InChIKey | ONZIGFMBQPPHKT-ZDUSSCGKSA-N |
| XLogP | 2.80 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |