C21H20N2O2S — CID 90596092
3-phenylsulfanyl-N-[(3-pyridin-2-yloxyphenyl)methyl]propanamide (PubChem CID 90596092) has the molecular formula C21H20N2O2S and a molecular weight of 364.47 g/mol. Its IUPAC name is 3-phenylsulfanyl-N-[(3-pyridin-2-yloxyphenyl)methyl]propanamide.
| Compound Name | 3-phenylsulfanyl-N-[(3-pyridin-2-yloxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 90596092 |
| Molecular Formula | C21H20N2O2S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 3-phenylsulfanyl-N-[(3-pyridin-2-yloxyphenyl)methyl]propanamide |
| SMILES | O=C(CCSc1ccccc1)NCc1cccc(Oc2ccccn2)c1 |
| InChI | InChI=1S/C21H20N2O2S/c24-20(12-14-26-19-9-2-1-3-10-19)23-16-17-7-6-8-18(15-17)25-21-11-4-5-13-22-21/h1-11,13,15H,12,14,16H2,(H,23,24) |
| InChIKey | MAELUNUKGACPGZ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |