C17H20N2O3S2 — CID 90598595
N-[2-methoxy-2-(5-methylthiophen-2-yl)ethyl]-N'-(2-methylsulfanylphenyl)oxamide (PubChem CID 90598595) has the molecular formula C17H20N2O3S2 and a molecular weight of 364.49 g/mol. Its IUPAC name is N-[2-methoxy-2-(5-methylthiophen-2-yl)ethyl]-N'-(2-methylsulfanylphenyl)oxamide.
| Compound Name | N-[2-methoxy-2-(5-methylthiophen-2-yl)ethyl]-N'-(2-methylsulfanylphenyl)oxamide |
|---|---|
| PubChem CID | 90598595 |
| Molecular Formula | C17H20N2O3S2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | N-[2-methoxy-2-(5-methylthiophen-2-yl)ethyl]-N'-(2-methylsulfanylphenyl)oxamide |
| SMILES | COC(CNC(=O)C(=O)Nc1ccccc1SC)c1ccc(C)s1 |
| InChI | InChI=1S/C17H20N2O3S2/c1-11-8-9-15(24-11)13(22-2)10-18-16(20)17(21)19-12-6-4-5-7-14(12)23-3/h4-9,13H,10H2,1-3H3,(H,18,20)(H,19,21) |
| InChIKey | VPGMYDBPGARXGC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|