C17H19F2NO3S — CID 90599242
1-(4-fluorophenyl)-N-[2-(2-fluorophenyl)-2-methoxypropyl]methanesulfonamide (PubChem CID 90599242) has the molecular formula C17H19F2NO3S and a molecular weight of 355.41 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[2-(2-fluorophenyl)-2-methoxypropyl]methanesulfonamide.
| Compound Name | 1-(4-fluorophenyl)-N-[2-(2-fluorophenyl)-2-methoxypropyl]methanesulfonamide |
|---|---|
| PubChem CID | 90599242 |
| Molecular Formula | C17H19F2NO3S |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[2-(2-fluorophenyl)-2-methoxypropyl]methanesulfonamide |
| SMILES | COC(C)(CNS(=O)(=O)Cc1ccc(F)cc1)c1ccccc1F |
| InChI | InChI=1S/C17H19F2NO3S/c1-17(23-2,15-5-3-4-6-16(15)19)12-20-24(21,22)11-13-7-9-14(18)10-8-13/h3-10,20H,11-12H2,1-2H3 |
| InChIKey | BKPXUXGPNWNGRC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |