C16H17BrFNO3S — CID 90599294
4-bromo-N-[2-(2-fluorophenyl)-2-methoxypropyl]benzenesulfonamide (PubChem CID 90599294) has the molecular formula C16H17BrFNO3S and a molecular weight of 402.29 g/mol. Its IUPAC name is 4-bromo-N-[2-(2-fluorophenyl)-2-methoxypropyl]benzenesulfonamide.
| Compound Name | 4-bromo-N-[2-(2-fluorophenyl)-2-methoxypropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90599294 |
| Molecular Formula | C16H17BrFNO3S |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 401.01 |
| IUPAC Name | 4-bromo-N-[2-(2-fluorophenyl)-2-methoxypropyl]benzenesulfonamide |
| SMILES | COC(C)(CNS(=O)(=O)c1ccc(Br)cc1)c1ccccc1F |
| InChI | InChI=1S/C16H17BrFNO3S/c1-16(22-2,14-5-3-4-6-15(14)18)11-19-23(20,21)13-9-7-12(17)8-10-13/h3-10,19H,11H2,1-2H3 |
| InChIKey | JOTLDPMYNLBNKW-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |