C18H20F2N2O2 — CID 90599796
1-(2,6-difluorophenyl)-3-(2-methoxy-2-phenylbutyl)urea (PubChem CID 90599796) has the molecular formula C18H20F2N2O2 and a molecular weight of 334.37 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-(2-methoxy-2-phenylbutyl)urea.
| Compound Name | 1-(2,6-difluorophenyl)-3-(2-methoxy-2-phenylbutyl)urea |
|---|---|
| PubChem CID | 90599796 |
| Molecular Formula | C18H20F2N2O2 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-(2-methoxy-2-phenylbutyl)urea |
| SMILES | CCC(CNC(=O)Nc1c(F)cccc1F)(OC)c1ccccc1 |
| InChI | InChI=1S/C18H20F2N2O2/c1-3-18(24-2,13-8-5-4-6-9-13)12-21-17(23)22-16-14(19)10-7-11-15(16)20/h4-11H,3,12H2,1-2H3,(H2,21,22,23) |
| InChIKey | JFQLCGAYMXVKQJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |