C20H23FN2O3 — CID 90599726
N-[(4-fluorophenyl)methyl]-N'-(2-methoxy-2-phenylbutyl)oxamide (PubChem CID 90599726) has the molecular formula C20H23FN2O3 and a molecular weight of 358.41 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N'-(2-methoxy-2-phenylbutyl)oxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-N'-(2-methoxy-2-phenylbutyl)oxamide |
|---|---|
| PubChem CID | 90599726 |
| Molecular Formula | C20H23FN2O3 |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N'-(2-methoxy-2-phenylbutyl)oxamide |
| SMILES | CCC(CNC(=O)C(=O)NCc1ccc(F)cc1)(OC)c1ccccc1 |
| InChI | InChI=1S/C20H23FN2O3/c1-3-20(26-2,16-7-5-4-6-8-16)14-23-19(25)18(24)22-13-15-9-11-17(21)12-10-15/h4-12H,3,13-14H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | QAQSVPCRGWWWDZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|