C19H22N4O2S — CID 90603321
2-(benzimidazol-1-yl)-1-[4-(2-hydroxy-2-thiophen-2-ylethyl)piperazin-1-yl]ethanone (PubChem CID 90603321) has the molecular formula C19H22N4O2S and a molecular weight of 370.48 g/mol. Its IUPAC name is 2-(benzimidazol-1-yl)-1-[4-(2-hydroxy-2-thiophen-2-ylethyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(benzimidazol-1-yl)-1-[4-(2-hydroxy-2-thiophen-2-ylethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 90603321 |
| Molecular Formula | C19H22N4O2S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 2-(benzimidazol-1-yl)-1-[4-(2-hydroxy-2-thiophen-2-ylethyl)piperazin-1-yl]ethanone |
| SMILES | O=C(Cn1cnc2ccccc21)N1CCN(CC(O)c2cccs2)CC1 |
| InChI | InChI=1S/C19H22N4O2S/c24-17(18-6-3-11-26-18)12-21-7-9-22(10-8-21)19(25)13-23-14-20-15-4-1-2-5-16(15)23/h1-6,11,14,17,24H,7-10,12-13H2 |
| InChIKey | FNVBSZNXFXWCCE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |