C18H18FN5O2S — CID 90604576
1-(4-fluoro-1,3-benzothiazol-2-yl)-N-[3-(6-oxopyridazin-1-yl)propyl]azetidine-3-carboxamide (PubChem CID 90604576) has the molecular formula C18H18FN5O2S and a molecular weight of 387.44 g/mol. Its IUPAC name is 1-(4-fluoro-1,3-benzothiazol-2-yl)-N-[3-(6-oxopyridazin-1-yl)propyl]azetidine-3-carboxamide.
| Compound Name | 1-(4-fluoro-1,3-benzothiazol-2-yl)-N-[3-(6-oxopyridazin-1-yl)propyl]azetidine-3-carboxamide |
|---|---|
| PubChem CID | 90604576 |
| Molecular Formula | C18H18FN5O2S |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 1-(4-fluoro-1,3-benzothiazol-2-yl)-N-[3-(6-oxopyridazin-1-yl)propyl]azetidine-3-carboxamide |
| SMILES | O=C(NCCCn1ncccc1=O)C1CN(c2nc3c(F)cccc3s2)C1 |
| InChI | InChI=1S/C18H18FN5O2S/c19-13-4-1-5-14-16(13)22-18(27-14)23-10-12(11-23)17(26)20-7-3-9-24-15(25)6-2-8-21-24/h1-2,4-6,8,12H,3,7,9-11H2,(H,20,26) |
| InChIKey | MWCUDEYCOQHNHI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|