C17H18ClN5O2S — CID 71790417
2-[(4-chloro-1,3-benzothiazol-2-yl)-methylamino]-N-[3-(6-oxopyridazin-1-yl)propyl]acetamide (PubChem CID 71790417) has the molecular formula C17H18ClN5O2S and a molecular weight of 391.88 g/mol. Its IUPAC name is 2-[(4-chloro-1,3-benzothiazol-2-yl)-methylamino]-N-[3-(6-oxopyridazin-1-yl)propyl]acetamide.
| Compound Name | 2-[(4-chloro-1,3-benzothiazol-2-yl)-methylamino]-N-[3-(6-oxopyridazin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 71790417 |
| Molecular Formula | C17H18ClN5O2S |
| Molecular Weight | 391.88 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 2-[(4-chloro-1,3-benzothiazol-2-yl)-methylamino]-N-[3-(6-oxopyridazin-1-yl)propyl]acetamide |
| SMILES | CN(CC(=O)NCCCn1ncccc1=O)c1nc2c(Cl)cccc2s1 |
| InChI | InChI=1S/C17H18ClN5O2S/c1-22(17-21-16-12(18)5-2-6-13(16)26-17)11-14(24)19-8-4-10-23-15(25)7-3-9-20-23/h2-3,5-7,9H,4,8,10-11H2,1H3,(H,19,24) |
| InChIKey | KQIVTTKDAYONCF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.88 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|