C20H25NO3S2 — CID 90604731
2,4-dimethyl-N-[(4-phenylsulfanyloxan-4-yl)methyl]benzenesulfonamide (PubChem CID 90604731) has the molecular formula C20H25NO3S2 and a molecular weight of 391.56 g/mol. Its IUPAC name is 2,4-dimethyl-N-[(4-phenylsulfanyloxan-4-yl)methyl]benzenesulfonamide.
| Compound Name | 2,4-dimethyl-N-[(4-phenylsulfanyloxan-4-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90604731 |
| Molecular Formula | C20H25NO3S2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 2,4-dimethyl-N-[(4-phenylsulfanyloxan-4-yl)methyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC2(Sc3ccccc3)CCOCC2)c(C)c1 |
| InChI | InChI=1S/C20H25NO3S2/c1-16-8-9-19(17(2)14-16)26(22,23)21-15-20(10-12-24-13-11-20)25-18-6-4-3-5-7-18/h3-9,14,21H,10-13,15H2,1-2H3 |
| InChIKey | PPSADWXIXQCUFC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |