C19H23NO4S2 — CID 90604736
4-methoxy-N-[(4-phenylsulfanyloxan-4-yl)methyl]benzenesulfonamide (PubChem CID 90604736) has the molecular formula C19H23NO4S2 and a molecular weight of 393.53 g/mol. Its IUPAC name is 4-methoxy-N-[(4-phenylsulfanyloxan-4-yl)methyl]benzenesulfonamide.
| Compound Name | 4-methoxy-N-[(4-phenylsulfanyloxan-4-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90604736 |
| Molecular Formula | C19H23NO4S2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 4-methoxy-N-[(4-phenylsulfanyloxan-4-yl)methyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCC2(Sc3ccccc3)CCOCC2)cc1 |
| InChI | InChI=1S/C19H23NO4S2/c1-23-16-7-9-18(10-8-16)26(21,22)20-15-19(11-13-24-14-12-19)25-17-5-3-2-4-6-17/h2-10,20H,11-15H2,1H3 |
| InChIKey | LFWQCHHBXKSBJE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |