C16H26N2O3S2 — CID 86807764
4-(dimethylamino)-N-[(4-ethylsulfanyloxan-4-yl)methyl]benzenesulfonamide (PubChem CID 86807764) has the molecular formula C16H26N2O3S2 and a molecular weight of 358.53 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[(4-ethylsulfanyloxan-4-yl)methyl]benzenesulfonamide.
| Compound Name | 4-(dimethylamino)-N-[(4-ethylsulfanyloxan-4-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 86807764 |
| Molecular Formula | C16H26N2O3S2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 4-(dimethylamino)-N-[(4-ethylsulfanyloxan-4-yl)methyl]benzenesulfonamide |
| SMILES | CCSC1(CNS(=O)(=O)c2ccc(N(C)C)cc2)CCOCC1 |
| InChI | InChI=1S/C16H26N2O3S2/c1-4-22-16(9-11-21-12-10-16)13-17-23(19,20)15-7-5-14(6-8-15)18(2)3/h5-8,17H,4,9-13H2,1-3H3 |
| InChIKey | SXXXRSOOBBEABZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |