C22H23NO3 — CID 90605067
N-[3-(furan-2-yl)-2-hydroxy-2-methylpropyl]-2,2-diphenylacetamide (PubChem CID 90605067) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is N-[3-(furan-2-yl)-2-hydroxy-2-methylpropyl]-2,2-diphenylacetamide.
| Compound Name | N-[3-(furan-2-yl)-2-hydroxy-2-methylpropyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 90605067 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | N-[3-(furan-2-yl)-2-hydroxy-2-methylpropyl]-2,2-diphenylacetamide |
| SMILES | CC(O)(CNC(=O)C(c1ccccc1)c1ccccc1)Cc1ccco1 |
| InChI | InChI=1S/C22H23NO3/c1-22(25,15-19-13-8-14-26-19)16-23-21(24)20(17-9-4-2-5-10-17)18-11-6-3-7-12-18/h2-14,20,25H,15-16H2,1H3,(H,23,24) |
| InChIKey | DVJJXGXTNHQDOI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |