C10H14N2O4 — CID 90605256
N'-[3-(furan-2-yl)-2-hydroxy-2-methylpropyl]oxamide (PubChem CID 90605256) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is N'-[3-(furan-2-yl)-2-hydroxy-2-methylpropyl]oxamide.
| Compound Name | N'-[3-(furan-2-yl)-2-hydroxy-2-methylpropyl]oxamide |
|---|---|
| PubChem CID | 90605256 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | N'-[3-(furan-2-yl)-2-hydroxy-2-methylpropyl]oxamide |
| SMILES | CC(O)(CNC(=O)C(N)=O)Cc1ccco1 |
| InChI | InChI=1S/C10H14N2O4/c1-10(15,5-7-3-2-4-16-7)6-12-9(14)8(11)13/h2-4,15H,5-6H2,1H3,(H2,11,13)(H,12,14) |
| InChIKey | ZMJTWCCUIIWKOB-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|