C16H17FN2O4 — CID 90605203
N'-(4-fluorophenyl)-N-[3-(furan-2-yl)-2-hydroxy-2-methylpropyl]oxamide (PubChem CID 90605203) has the molecular formula C16H17FN2O4 and a molecular weight of 320.32 g/mol. Its IUPAC name is N'-(4-fluorophenyl)-N-[3-(furan-2-yl)-2-hydroxy-2-methylpropyl]oxamide.
| Compound Name | N'-(4-fluorophenyl)-N-[3-(furan-2-yl)-2-hydroxy-2-methylpropyl]oxamide |
|---|---|
| PubChem CID | 90605203 |
| Molecular Formula | C16H17FN2O4 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | N'-(4-fluorophenyl)-N-[3-(furan-2-yl)-2-hydroxy-2-methylpropyl]oxamide |
| SMILES | CC(O)(CNC(=O)C(=O)Nc1ccc(F)cc1)Cc1ccco1 |
| InChI | InChI=1S/C16H17FN2O4/c1-16(22,9-13-3-2-8-23-13)10-18-14(20)15(21)19-12-6-4-11(17)5-7-12/h2-8,22H,9-10H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | HRBUETDHJNMBMN-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|