C20H24FNO4 — CID 90605098
4-(4-fluorophenyl)-N-[3-(furan-2-yl)-2-hydroxy-2-methylpropyl]oxane-4-carboxamide (PubChem CID 90605098) has the molecular formula C20H24FNO4 and a molecular weight of 361.41 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-[3-(furan-2-yl)-2-hydroxy-2-methylpropyl]oxane-4-carboxamide.
| Compound Name | 4-(4-fluorophenyl)-N-[3-(furan-2-yl)-2-hydroxy-2-methylpropyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 90605098 |
| Molecular Formula | C20H24FNO4 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 4-(4-fluorophenyl)-N-[3-(furan-2-yl)-2-hydroxy-2-methylpropyl]oxane-4-carboxamide |
| SMILES | CC(O)(CNC(=O)C1(c2ccc(F)cc2)CCOCC1)Cc1ccco1 |
| InChI | InChI=1S/C20H24FNO4/c1-19(24,13-17-3-2-10-26-17)14-22-18(23)20(8-11-25-12-9-20)15-4-6-16(21)7-5-15/h2-7,10,24H,8-9,11-14H2,1H3,(H,22,23) |
| InChIKey | PHNFCSLGRYCPCR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |