C16H19FN2O3 — CID 90605292
1-[(4-fluorophenyl)methyl]-3-[3-(furan-2-yl)-2-hydroxy-2-methylpropyl]urea (PubChem CID 90605292) has the molecular formula C16H19FN2O3 and a molecular weight of 306.34 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-[3-(furan-2-yl)-2-hydroxy-2-methylpropyl]urea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-[3-(furan-2-yl)-2-hydroxy-2-methylpropyl]urea |
|---|---|
| PubChem CID | 90605292 |
| Molecular Formula | C16H19FN2O3 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-[3-(furan-2-yl)-2-hydroxy-2-methylpropyl]urea |
| SMILES | CC(O)(CNC(=O)NCc1ccc(F)cc1)Cc1ccco1 |
| InChI | InChI=1S/C16H19FN2O3/c1-16(21,9-14-3-2-8-22-14)11-19-15(20)18-10-12-4-6-13(17)7-5-12/h2-8,21H,9-11H2,1H3,(H2,18,19,20) |
| InChIKey | RUKBMUDROGJFNT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |