C14H14FN3O2S2 — CID 90605895
2-[(4-fluoro-1,3-benzothiazol-2-yl)-methylamino]-N-(2-oxothiolan-3-yl)acetamide (PubChem CID 90605895) has the molecular formula C14H14FN3O2S2 and a molecular weight of 339.42 g/mol. Its IUPAC name is 2-[(4-fluoro-1,3-benzothiazol-2-yl)-methylamino]-N-(2-oxothiolan-3-yl)acetamide.
| Compound Name | 2-[(4-fluoro-1,3-benzothiazol-2-yl)-methylamino]-N-(2-oxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 90605895 |
| Molecular Formula | C14H14FN3O2S2 |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 2-[(4-fluoro-1,3-benzothiazol-2-yl)-methylamino]-N-(2-oxothiolan-3-yl)acetamide |
| SMILES | CN(CC(=O)NC1CCSC1=O)c1nc2c(F)cccc2s1 |
| InChI | InChI=1S/C14H14FN3O2S2/c1-18(7-11(19)16-9-5-6-21-13(9)20)14-17-12-8(15)3-2-4-10(12)22-14/h2-4,9H,5-7H2,1H3,(H,16,19) |
| InChIKey | ZJMFLFBPWUQXQG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|