C12H14FN3O2S — CID 90605927
2-[(4-fluoro-1,3-benzothiazol-2-yl)-methylamino]-N-methoxy-N-methylacetamide (PubChem CID 90605927) has the molecular formula C12H14FN3O2S and a molecular weight of 283.33 g/mol. Its IUPAC name is 2-[(4-fluoro-1,3-benzothiazol-2-yl)-methylamino]-N-methoxy-N-methylacetamide.
| Compound Name | 2-[(4-fluoro-1,3-benzothiazol-2-yl)-methylamino]-N-methoxy-N-methylacetamide |
|---|---|
| PubChem CID | 90605927 |
| Molecular Formula | C12H14FN3O2S |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 2-[(4-fluoro-1,3-benzothiazol-2-yl)-methylamino]-N-methoxy-N-methylacetamide |
| SMILES | CON(C)C(=O)CN(C)c1nc2c(F)cccc2s1 |
| InChI | InChI=1S/C12H14FN3O2S/c1-15(7-10(17)16(2)18-3)12-14-11-8(13)5-4-6-9(11)19-12/h4-6H,7H2,1-3H3 |
| InChIKey | GFLQLIPKCDSWLW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|