C18H13F3N2O2S — CID 90606809
[1-(1,3-benzothiazol-2-yl)azetidin-3-yl] 2-(trifluoromethyl)benzoate (PubChem CID 90606809) has the molecular formula C18H13F3N2O2S and a molecular weight of 378.38 g/mol. Its IUPAC name is [1-(1,3-benzothiazol-2-yl)azetidin-3-yl] 2-(trifluoromethyl)benzoate.
| Compound Name | [1-(1,3-benzothiazol-2-yl)azetidin-3-yl] 2-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 90606809 |
| Molecular Formula | C18H13F3N2O2S |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | [1-(1,3-benzothiazol-2-yl)azetidin-3-yl] 2-(trifluoromethyl)benzoate |
| SMILES | O=C(OC1CN(c2nc3ccccc3s2)C1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H13F3N2O2S/c19-18(20,21)13-6-2-1-5-12(13)16(24)25-11-9-23(10-11)17-22-14-7-3-4-8-15(14)26-17/h1-8,11H,9-10H2 |
| InChIKey | GXRQFLNFFRSYAB-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |