C17H11Cl2FN2O2S — CID 90606575
[1-(6-fluoro-1,3-benzothiazol-2-yl)azetidin-3-yl] 2,4-dichlorobenzoate (PubChem CID 90606575) has the molecular formula C17H11Cl2FN2O2S and a molecular weight of 397.26 g/mol. Its IUPAC name is [1-(6-fluoro-1,3-benzothiazol-2-yl)azetidin-3-yl] 2,4-dichlorobenzoate.
| Compound Name | [1-(6-fluoro-1,3-benzothiazol-2-yl)azetidin-3-yl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 90606575 |
| Molecular Formula | C17H11Cl2FN2O2S |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 395.99 |
| IUPAC Name | [1-(6-fluoro-1,3-benzothiazol-2-yl)azetidin-3-yl] 2,4-dichlorobenzoate |
| SMILES | O=C(OC1CN(c2nc3ccc(F)cc3s2)C1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H11Cl2FN2O2S/c18-9-1-3-12(13(19)5-9)16(23)24-11-7-22(8-11)17-21-14-4-2-10(20)6-15(14)25-17/h1-6,11H,7-8H2 |
| InChIKey | ZZVTUVSRUVELPZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |