C15H10FN3O4S2 — CID 90606662
[1-(6-fluoro-1,3-benzothiazol-2-yl)azetidin-3-yl] 5-nitrothiophene-2-carboxylate (PubChem CID 90606662) has the molecular formula C15H10FN3O4S2 and a molecular weight of 379.39 g/mol. Its IUPAC name is [1-(6-fluoro-1,3-benzothiazol-2-yl)azetidin-3-yl] 5-nitrothiophene-2-carboxylate.
| Compound Name | [1-(6-fluoro-1,3-benzothiazol-2-yl)azetidin-3-yl] 5-nitrothiophene-2-carboxylate |
|---|---|
| PubChem CID | 90606662 |
| Molecular Formula | C15H10FN3O4S2 |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | [1-(6-fluoro-1,3-benzothiazol-2-yl)azetidin-3-yl] 5-nitrothiophene-2-carboxylate |
| SMILES | O=C(OC1CN(c2nc3ccc(F)cc3s2)C1)c1ccc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C15H10FN3O4S2/c16-8-1-2-10-12(5-8)25-15(17-10)18-6-9(7-18)23-14(20)11-3-4-13(24-11)19(21)22/h1-5,9H,6-7H2 |
| InChIKey | BLTSYWHQLFBXAS-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|