C23H25FN2O5S — CID 90606563
[1-(6-fluoro-1,3-benzothiazol-2-yl)azetidin-3-yl] 3,4,5-triethoxybenzoate (PubChem CID 90606563) has the molecular formula C23H25FN2O5S and a molecular weight of 460.53 g/mol. Its IUPAC name is [1-(6-fluoro-1,3-benzothiazol-2-yl)azetidin-3-yl] 3,4,5-triethoxybenzoate.
| Compound Name | [1-(6-fluoro-1,3-benzothiazol-2-yl)azetidin-3-yl] 3,4,5-triethoxybenzoate |
|---|---|
| PubChem CID | 90606563 |
| Molecular Formula | C23H25FN2O5S |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | [1-(6-fluoro-1,3-benzothiazol-2-yl)azetidin-3-yl] 3,4,5-triethoxybenzoate |
| SMILES | CCOc1cc(C(=O)OC2CN(c3nc4ccc(F)cc4s3)C2)cc(OCC)c1OCC |
| InChI | InChI=1S/C23H25FN2O5S/c1-4-28-18-9-14(10-19(29-5-2)21(18)30-6-3)22(27)31-16-12-26(13-16)23-25-17-8-7-15(24)11-20(17)32-23/h7-11,16H,4-6,12-13H2,1-3H3 |
| InChIKey | OMAZOXSLKYQFHH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |