C21H21FN2O3S — CID 90606673
[1-(6-fluoro-1,3-benzothiazol-2-yl)azetidin-3-yl] 3-butoxybenzoate (PubChem CID 90606673) has the molecular formula C21H21FN2O3S and a molecular weight of 400.48 g/mol. Its IUPAC name is [1-(6-fluoro-1,3-benzothiazol-2-yl)azetidin-3-yl] 3-butoxybenzoate.
| Compound Name | [1-(6-fluoro-1,3-benzothiazol-2-yl)azetidin-3-yl] 3-butoxybenzoate |
|---|---|
| PubChem CID | 90606673 |
| Molecular Formula | C21H21FN2O3S |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | [1-(6-fluoro-1,3-benzothiazol-2-yl)azetidin-3-yl] 3-butoxybenzoate |
| SMILES | CCCCOc1cccc(C(=O)OC2CN(c3nc4ccc(F)cc4s3)C2)c1 |
| InChI | InChI=1S/C21H21FN2O3S/c1-2-3-9-26-16-6-4-5-14(10-16)20(25)27-17-12-24(13-17)21-23-18-8-7-15(22)11-19(18)28-21/h4-8,10-11,17H,2-3,9,12-13H2,1H3 |
| InChIKey | CQPVHFVMBSZVPA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|