C21H22FN3O4S2 — CID 90606623
[1-(6-fluoro-1,3-benzothiazol-2-yl)azetidin-3-yl] 4-(diethylsulfamoyl)benzoate (PubChem CID 90606623) has the molecular formula C21H22FN3O4S2 and a molecular weight of 463.56 g/mol. Its IUPAC name is [1-(6-fluoro-1,3-benzothiazol-2-yl)azetidin-3-yl] 4-(diethylsulfamoyl)benzoate.
| Compound Name | [1-(6-fluoro-1,3-benzothiazol-2-yl)azetidin-3-yl] 4-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 90606623 |
| Molecular Formula | C21H22FN3O4S2 |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | [1-(6-fluoro-1,3-benzothiazol-2-yl)azetidin-3-yl] 4-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)OC2CN(c3nc4ccc(F)cc4s3)C2)cc1 |
| InChI | InChI=1S/C21H22FN3O4S2/c1-3-25(4-2)31(27,28)17-8-5-14(6-9-17)20(26)29-16-12-24(13-16)21-23-18-10-7-15(22)11-19(18)30-21/h5-11,16H,3-4,12-13H2,1-2H3 |
| InChIKey | UGYFNFHWQFIRRD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |