C23H27N3O4S2 — CID 90606878
[1-(1,3-benzothiazol-2-yl)azetidin-3-yl] 4-(dipropylsulfamoyl)benzoate (PubChem CID 90606878) has the molecular formula C23H27N3O4S2 and a molecular weight of 473.62 g/mol. Its IUPAC name is [1-(1,3-benzothiazol-2-yl)azetidin-3-yl] 4-(dipropylsulfamoyl)benzoate.
| Compound Name | [1-(1,3-benzothiazol-2-yl)azetidin-3-yl] 4-(dipropylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 90606878 |
| Molecular Formula | C23H27N3O4S2 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | [1-(1,3-benzothiazol-2-yl)azetidin-3-yl] 4-(dipropylsulfamoyl)benzoate |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(C(=O)OC2CN(c3nc4ccccc4s3)C2)cc1 |
| InChI | InChI=1S/C23H27N3O4S2/c1-3-13-26(14-4-2)32(28,29)19-11-9-17(10-12-19)22(27)30-18-15-25(16-18)23-24-20-7-5-6-8-21(20)31-23/h5-12,18H,3-4,13-16H2,1-2H3 |
| InChIKey | VQIIITNJUJUSMI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |