C18H23N3O3 — CID 90613816
3,4-dimethoxy-N-[2-(4,5,6,7-tetrahydroindazol-1-yl)ethyl]benzamide (PubChem CID 90613816) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[2-(4,5,6,7-tetrahydroindazol-1-yl)ethyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[2-(4,5,6,7-tetrahydroindazol-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 90613816 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 3,4-dimethoxy-N-[2-(4,5,6,7-tetrahydroindazol-1-yl)ethyl]benzamide |
| SMILES | COc1ccc(C(=O)NCCn2ncc3c2CCCC3)cc1OC |
| InChI | InChI=1S/C18H23N3O3/c1-23-16-8-7-13(11-17(16)24-2)18(22)19-9-10-21-15-6-4-3-5-14(15)12-20-21/h7-8,11-12H,3-6,9-10H2,1-2H3,(H,19,22) |
| InChIKey | FOYDRBOXPIYHIP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |