C16H17Cl2N3O — CID 90613838
2,4-dichloro-N-[2-(4,5,6,7-tetrahydroindazol-1-yl)ethyl]benzamide (PubChem CID 90613838) has the molecular formula C16H17Cl2N3O and a molecular weight of 338.24 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-(4,5,6,7-tetrahydroindazol-1-yl)ethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-(4,5,6,7-tetrahydroindazol-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 90613838 |
| Molecular Formula | C16H17Cl2N3O |
| Molecular Weight | 338.24 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 2,4-dichloro-N-[2-(4,5,6,7-tetrahydroindazol-1-yl)ethyl]benzamide |
| SMILES | O=C(NCCn1ncc2c1CCCC2)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H17Cl2N3O/c17-12-5-6-13(14(18)9-12)16(22)19-7-8-21-15-4-2-1-3-11(15)10-20-21/h5-6,9-10H,1-4,7-8H2,(H,19,22) |
| InChIKey | IHQMVLZJUIHBOT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.24 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |