C16H18ClN3O — CID 90613758
2-chloro-N-[2-(4,5,6,7-tetrahydroindazol-1-yl)ethyl]benzamide (PubChem CID 90613758) has the molecular formula C16H18ClN3O and a molecular weight of 303.79 g/mol. Its IUPAC name is 2-chloro-N-[2-(4,5,6,7-tetrahydroindazol-1-yl)ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-(4,5,6,7-tetrahydroindazol-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 90613758 |
| Molecular Formula | C16H18ClN3O |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 2-chloro-N-[2-(4,5,6,7-tetrahydroindazol-1-yl)ethyl]benzamide |
| SMILES | O=C(NCCn1ncc2c1CCCC2)c1ccccc1Cl |
| InChI | InChI=1S/C16H18ClN3O/c17-14-7-3-2-6-13(14)16(21)18-9-10-20-15-8-4-1-5-12(15)11-19-20/h2-3,6-7,11H,1,4-5,8-10H2,(H,18,21) |
| InChIKey | ITOGXQYVMAJRPU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |