C21H20ClN5O3 — CID 90614544
5-chloro-2-nitro-N-[2-(3-pyridin-2-yl-4,5,6,7-tetrahydroindazol-1-yl)ethyl]benzamide (PubChem CID 90614544) has the molecular formula C21H20ClN5O3 and a molecular weight of 425.88 g/mol. Its IUPAC name is 5-chloro-2-nitro-N-[2-(3-pyridin-2-yl-4,5,6,7-tetrahydroindazol-1-yl)ethyl]benzamide.
| Compound Name | 5-chloro-2-nitro-N-[2-(3-pyridin-2-yl-4,5,6,7-tetrahydroindazol-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 90614544 |
| Molecular Formula | C21H20ClN5O3 |
| Molecular Weight | 425.88 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 5-chloro-2-nitro-N-[2-(3-pyridin-2-yl-4,5,6,7-tetrahydroindazol-1-yl)ethyl]benzamide |
| SMILES | O=C(NCCn1nc(-c2ccccn2)c2c1CCCC2)c1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H20ClN5O3/c22-14-8-9-19(27(29)30)16(13-14)21(28)24-11-12-26-18-7-2-1-5-15(18)20(25-26)17-6-3-4-10-23-17/h3-4,6,8-10,13H,1-2,5,7,11-12H2,(H,24,28) |
| InChIKey | OKOZVZZWSATOQP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.88 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|