C19H20N4O2 — CID 90619144
1-[[1-(1,3-benzoxazol-2-yl)pyrrolidin-2-yl]methyl]-3-phenylurea (PubChem CID 90619144) has the molecular formula C19H20N4O2 and a molecular weight of 336.39 g/mol. Its IUPAC name is 1-[[1-(1,3-benzoxazol-2-yl)pyrrolidin-2-yl]methyl]-3-phenylurea.
| Compound Name | 1-[[1-(1,3-benzoxazol-2-yl)pyrrolidin-2-yl]methyl]-3-phenylurea |
|---|---|
| PubChem CID | 90619144 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 1-[[1-(1,3-benzoxazol-2-yl)pyrrolidin-2-yl]methyl]-3-phenylurea |
| SMILES | O=C(NCC1CCCN1c1nc2ccccc2o1)Nc1ccccc1 |
| InChI | InChI=1S/C19H20N4O2/c24-18(21-14-7-2-1-3-8-14)20-13-15-9-6-12-23(15)19-22-16-10-4-5-11-17(16)25-19/h1-5,7-8,10-11,15H,6,9,12-13H2,(H2,20,21,24) |
| InChIKey | KCMAPRZFJBWXJN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |