C20H21N3O5S — CID 90619259
methyl 4-[[1-(1,3-benzoxazol-2-yl)pyrrolidin-2-yl]methylsulfamoyl]benzoate (PubChem CID 90619259) has the molecular formula C20H21N3O5S and a molecular weight of 415.47 g/mol. Its IUPAC name is methyl 4-[[1-(1,3-benzoxazol-2-yl)pyrrolidin-2-yl]methylsulfamoyl]benzoate.
| Compound Name | methyl 4-[[1-(1,3-benzoxazol-2-yl)pyrrolidin-2-yl]methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 90619259 |
| Molecular Formula | C20H21N3O5S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | methyl 4-[[1-(1,3-benzoxazol-2-yl)pyrrolidin-2-yl]methylsulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NCC2CCCN2c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C20H21N3O5S/c1-27-19(24)14-8-10-16(11-9-14)29(25,26)21-13-15-5-4-12-23(15)20-22-17-6-2-3-7-18(17)28-20/h2-3,6-11,15,21H,4-5,12-13H2,1H3 |
| InChIKey | QZWSMBDXULGOLW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |