C23H28N4O4S — CID 90619125
N-[[1-(1,3-benzoxazol-2-yl)pyrrolidin-2-yl]methyl]-4-(diethylsulfamoyl)benzamide (PubChem CID 90619125) has the molecular formula C23H28N4O4S and a molecular weight of 456.57 g/mol. Its IUPAC name is N-[[1-(1,3-benzoxazol-2-yl)pyrrolidin-2-yl]methyl]-4-(diethylsulfamoyl)benzamide.
| Compound Name | N-[[1-(1,3-benzoxazol-2-yl)pyrrolidin-2-yl]methyl]-4-(diethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 90619125 |
| Molecular Formula | C23H28N4O4S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | N-[[1-(1,3-benzoxazol-2-yl)pyrrolidin-2-yl]methyl]-4-(diethylsulfamoyl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)NCC2CCCN2c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C23H28N4O4S/c1-3-26(4-2)32(29,30)19-13-11-17(12-14-19)22(28)24-16-18-8-7-15-27(18)23-25-20-9-5-6-10-21(20)31-23/h5-6,9-14,18H,3-4,7-8,15-16H2,1-2H3,(H,24,28) |
| InChIKey | PAWZMKOIIZOZCF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |