C23H27N3O4 — CID 90619088
N-[[1-(1,3-benzoxazol-2-yl)pyrrolidin-2-yl]methyl]-3,4-diethoxybenzamide (PubChem CID 90619088) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is N-[[1-(1,3-benzoxazol-2-yl)pyrrolidin-2-yl]methyl]-3,4-diethoxybenzamide.
| Compound Name | N-[[1-(1,3-benzoxazol-2-yl)pyrrolidin-2-yl]methyl]-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 90619088 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | N-[[1-(1,3-benzoxazol-2-yl)pyrrolidin-2-yl]methyl]-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NCC2CCCN2c2nc3ccccc3o2)cc1OCC |
| InChI | InChI=1S/C23H27N3O4/c1-3-28-20-12-11-16(14-21(20)29-4-2)22(27)24-15-17-8-7-13-26(17)23-25-18-9-5-6-10-19(18)30-23/h5-6,9-12,14,17H,3-4,7-8,13,15H2,1-2H3,(H,24,27) |
| InChIKey | GZHYGECATYIDKW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |