C23H21N3O2S — CID 90618959
N-[[1-(1,3-benzoxazol-2-yl)pyrrolidin-2-yl]methyl]-4-thiophen-3-ylbenzamide (PubChem CID 90618959) has the molecular formula C23H21N3O2S and a molecular weight of 403.51 g/mol. Its IUPAC name is N-[[1-(1,3-benzoxazol-2-yl)pyrrolidin-2-yl]methyl]-4-thiophen-3-ylbenzamide.
| Compound Name | N-[[1-(1,3-benzoxazol-2-yl)pyrrolidin-2-yl]methyl]-4-thiophen-3-ylbenzamide |
|---|---|
| PubChem CID | 90618959 |
| Molecular Formula | C23H21N3O2S |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | N-[[1-(1,3-benzoxazol-2-yl)pyrrolidin-2-yl]methyl]-4-thiophen-3-ylbenzamide |
| SMILES | O=C(NCC1CCCN1c1nc2ccccc2o1)c1ccc(-c2ccsc2)cc1 |
| InChI | InChI=1S/C23H21N3O2S/c27-22(17-9-7-16(8-10-17)18-11-13-29-15-18)24-14-19-4-3-12-26(19)23-25-20-5-1-2-6-21(20)28-23/h1-2,5-11,13,15,19H,3-4,12,14H2,(H,24,27) |
| InChIKey | JJNMFPXSDAPNBY-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |