C23H20FNO4 — CID 90620312
methyl 4-(2-fluorophenoxy)-1-(naphthalene-2-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 90620312) has the molecular formula C23H20FNO4 and a molecular weight of 393.41 g/mol. Its IUPAC name is methyl 4-(2-fluorophenoxy)-1-(naphthalene-2-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl 4-(2-fluorophenoxy)-1-(naphthalene-2-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 90620312 |
| Molecular Formula | C23H20FNO4 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | methyl 4-(2-fluorophenoxy)-1-(naphthalene-2-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CC(Oc2ccccc2F)CN1C(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H20FNO4/c1-28-23(27)20-13-18(29-21-9-5-4-8-19(21)24)14-25(20)22(26)17-11-10-15-6-2-3-7-16(15)12-17/h2-12,18,20H,13-14H2,1H3 |
| InChIKey | YWDLXGMAFKHLOK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |