C15H13F6NO4 — CID 90620343
methyl 4-(2-fluorophenoxy)-1-(2,2,3,3,3-pentafluoropropanoyl)pyrrolidine-2-carboxylate (PubChem CID 90620343) has the molecular formula C15H13F6NO4 and a molecular weight of 385.26 g/mol. Its IUPAC name is methyl 4-(2-fluorophenoxy)-1-(2,2,3,3,3-pentafluoropropanoyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl 4-(2-fluorophenoxy)-1-(2,2,3,3,3-pentafluoropropanoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 90620343 |
| Molecular Formula | C15H13F6NO4 |
| Molecular Weight | 385.26 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | methyl 4-(2-fluorophenoxy)-1-(2,2,3,3,3-pentafluoropropanoyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CC(Oc2ccccc2F)CN1C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H13F6NO4/c1-25-12(23)10-6-8(26-11-5-3-2-4-9(11)16)7-22(10)13(24)14(17,18)15(19,20)21/h2-5,8,10H,6-7H2,1H3 |
| InChIKey | XZFXRRNJMIMTDH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|